C26H38N2O7S — CID 5279195
tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropoxy)amino]-1-phenylbutan-2-yl]carbamate (PubChem CID 5279195) has the molecular formula C26H38N2O7S and a molecular weight of 522.66 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropoxy)amino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropoxy)amino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 5279195 |
| Molecular Formula | C26H38N2O7S |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropoxy)amino]-1-phenylbutan-2-yl]carbamate |
| SMILES | COc1ccc(S(=O)(=O)N(C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)OCC(C)C)cc1 |
| InChI | InChI=1S/C26H38N2O7S/c1-19(2)18-34-28(36(31,32)22-14-12-21(33-6)13-15-22)17-24(29)23(16-20-10-8-7-9-11-20)27-25(30)35-26(3,4)5/h7-15,19,23-24,29H,16-18H2,1-6H3,(H,27,30)/t23-,24+/m0/s1 |
| InChIKey | ZMTSUDMDVPYUFD-BJKOFHAPSA-N |
| XLogP | 3.77 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|