C24H44N4O7SSi2 — CID 5279509
1-[(5R,6S,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-7-oxa-2λ6-thia-1-azaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 5279509) has the molecular formula C24H44N4O7SSi2 and a molecular weight of 588.88 g/mol. Its IUPAC name is 1-[(5R,6S,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-7-oxa-2λ6-thia-1-azaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(5R,6S,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-7-oxa-2λ6-thia-1-azaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5279509 |
| Molecular Formula | C24H44N4O7SSi2 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | 1-[(5R,6S,8R,9R)-4-amino-9-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dioxo-7-oxa-2λ6-thia-1-azaspiro[4.4]non-3-en-8-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@]3(NS(=O)(=O)C=C3N)[C@H]2O[Si](C)(C)C(C)(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C24H44N4O7SSi2/c1-15-12-28(21(30)26-19(15)29)20-18(35-38(10,11)23(5,6)7)24(16(25)14-36(31,32)27-24)17(34-20)13-33-37(8,9)22(2,3)4/h12,14,17-18,20,27H,13,25H2,1-11H3,(H,26,29,30)/t17-,18+,20-,24-/m1/s1 |
| InChIKey | NGUANTOMOGTWJQ-DSPLJNTKSA-N |
| XLogP | 2.63 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|