C17H16N2O4S — CID 52795671
4-(methylsulfonylmethyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)benzamide (PubChem CID 52795671) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)benzamide.
| Compound Name | 4-(methylsulfonylmethyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)benzamide |
|---|---|
| PubChem CID | 52795671 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-(methylsulfonylmethyl)-N-(3-oxo-1,2-dihydroisoindol-5-yl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2ccc3c(c2)C(=O)NC3)cc1 |
| InChI | InChI=1S/C17H16N2O4S/c1-24(22,23)10-11-2-4-12(5-3-11)16(20)19-14-7-6-13-9-18-17(21)15(13)8-14/h2-8H,9-10H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | QFZUDSFZRJFJLE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |