C23H15ClN6 — CID 5279609
7-chloro-3,11-diphenyl-2,4,5,9,10,12-hexazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene (PubChem CID 5279609) has the molecular formula C23H15ClN6 and a molecular weight of 410.87 g/mol. Its IUPAC name is 7-chloro-3,11-diphenyl-2,4,5,9,10,12-hexazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene.
| Compound Name | 7-chloro-3,11-diphenyl-2,4,5,9,10,12-hexazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene |
|---|---|
| PubChem CID | 5279609 |
| Molecular Formula | C23H15ClN6 |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 7-chloro-3,11-diphenyl-2,4,5,9,10,12-hexazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(17),3,5,8,10,13,15-heptaene |
| SMILES | ClC1c2nnc(-c3ccccc3)n2-c2ccccc2-n2c(-c3ccccc3)nnc21 |
| InChI | InChI=1S/C23H15ClN6/c24-19-22-27-25-20(15-9-3-1-4-10-15)29(22)17-13-7-8-14-18(17)30-21(26-28-23(19)30)16-11-5-2-6-12-16/h1-14,19H |
| InChIKey | YMUKUPGQSUPFEP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|