C24H18ClFN8O2 — CID 5279802
1-[4-(3-chloroisoquinolin-1-yl)piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 5279802) has the molecular formula C24H18ClFN8O2 and a molecular weight of 504.91 g/mol. Its IUPAC name is 1-[4-(3-chloroisoquinolin-1-yl)piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[4-(3-chloroisoquinolin-1-yl)piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5279802 |
| Molecular Formula | C24H18ClFN8O2 |
| Molecular Weight | 504.91 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 1-[4-(3-chloroisoquinolin-1-yl)piperazin-1-yl]-2-[4-fluoro-7-(triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(c2nc(Cl)cc3ccccc23)CC1)c1c[nH]c2c(-n3ccnn3)ncc(F)c12 |
| InChI | InChI=1S/C24H18ClFN8O2/c25-18-11-14-3-1-2-4-15(14)22(30-18)32-7-9-33(10-8-32)24(36)21(35)16-12-27-20-19(16)17(26)13-28-23(20)34-6-5-29-31-34/h1-6,11-13,27H,7-10H2 |
| InChIKey | ZSXNKWHZNWELFA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.91 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|