C26H22N8O3 — CID 5279838
2-[1-[2-[7-(5-aminopyrazin-2-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperidin-4-ylidene]-2-pyridin-2-ylacetonitrile (PubChem CID 5279838) has the molecular formula C26H22N8O3 and a molecular weight of 494.52 g/mol. Its IUPAC name is 2-[1-[2-[7-(5-aminopyrazin-2-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperidin-4-ylidene]-2-pyridin-2-ylacetonitrile.
| Compound Name | 2-[1-[2-[7-(5-aminopyrazin-2-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperidin-4-ylidene]-2-pyridin-2-ylacetonitrile |
|---|---|
| PubChem CID | 5279838 |
| Molecular Formula | C26H22N8O3 |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 2-[1-[2-[7-(5-aminopyrazin-2-yl)-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]piperidin-4-ylidene]-2-pyridin-2-ylacetonitrile |
| SMILES | COc1cnc(-c2cnc(N)cn2)c2[nH]cc(C(=O)C(=O)N3CCC(=C(C#N)c4ccccn4)CC3)c12 |
| InChI | InChI=1S/C26H22N8O3/c1-37-20-13-33-23(19-12-31-21(28)14-30-19)24-22(20)17(11-32-24)25(35)26(36)34-8-5-15(6-9-34)16(10-27)18-4-2-3-7-29-18/h2-4,7,11-14,32H,5-6,8-9H2,1H3,(H2,28,31) |
| InChIKey | DRKWXDIOCGWLIG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 163.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|