C23H24N2O3 — CID 5280007
1-benzyl-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione (PubChem CID 5280007) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-benzyl-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione.
| Compound Name | 1-benzyl-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 5280007 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-benzyl-6-(3,5-dimethylbenzoyl)-5-propan-2-ylpyrimidine-2,4-dione |
| SMILES | Cc1cc(C)cc(C(=O)c2c(C(C)C)c(=O)[nH]c(=O)n2Cc2ccccc2)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-14(2)19-20(21(26)18-11-15(3)10-16(4)12-18)25(23(28)24-22(19)27)13-17-8-6-5-7-9-17/h5-12,14H,13H2,1-4H3,(H,24,27,28) |
| InChIKey | XZKWHOTXDXTUIM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |