About 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione
1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione (PubChem CID 5280008) has the molecular formula C22H22N2O3
and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
| PubChem CID | 5280008 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione |
| SMILES | CCc1c(C(=O)c2cc(C)cc(C)c2)n(Cc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C22H22N2O3/c1-4-18-19(20(25)17-11-14(2)10-15(3)12-17)24(22(27)23-21(18)26)13-16-8-6-5-7-9-16/h5-12H,4,13H2,1-3H3,(H,23,26,27) |
| InChIKey | LHJSBTOSBYRXRM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione?
The IUPAC name of 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione (CID 5280008) is 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione.
What is the SMILES notation for 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione?
The canonical SMILES for 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione is CCc1c(C(=O)c2cc(C)cc(C)c2)n(Cc2ccccc2)c(=O)[nH]c1=O.
What is the InChIKey of 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione?
The InChIKey is LHJSBTOSBYRXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3/c1-4-18-19(20(25)17-11-14(2)10-15(3)12-17)24(22(27)23-21(18)26)13-16-8-6-5-7-9-16/h5-12H,4,13H2,1-3H3,(H,23,26,27).
What are the key properties of 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione?
1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione has a molecular weight of 362.43 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-6-(3,5-dimethylbenzoyl)-5-ethylpyrimidine-2,4-dione is sourced from PubChem (CID 5280008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).