C25H21N3O — CID 52800122
3-[(E)-[(5Z)-5-[(3-cyanophenyl)methylidene]-1-(cyclopropylmethyl)-4-oxopiperidin-3-ylidene]methyl]benzonitrile (PubChem CID 52800122) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 3-[(E)-[(5Z)-5-[(3-cyanophenyl)methylidene]-1-(cyclopropylmethyl)-4-oxopiperidin-3-ylidene]methyl]benzonitrile.
| Compound Name | 3-[(E)-[(5Z)-5-[(3-cyanophenyl)methylidene]-1-(cyclopropylmethyl)-4-oxopiperidin-3-ylidene]methyl]benzonitrile |
|---|---|
| PubChem CID | 52800122 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-[(E)-[(5Z)-5-[(3-cyanophenyl)methylidene]-1-(cyclopropylmethyl)-4-oxopiperidin-3-ylidene]methyl]benzonitrile |
| SMILES | N#Cc1cccc(/C=C2/CN(CC3CC3)C/C(=C\c3cccc(C#N)c3)C2=O)c1 |
| InChI | InChI=1S/C25H21N3O/c26-13-21-5-1-3-19(9-21)11-23-16-28(15-18-7-8-18)17-24(25(23)29)12-20-4-2-6-22(10-20)14-27/h1-6,9-12,18H,7-8,15-17H2/b23-11-,24-12+ |
| InChIKey | CRTNFELDANELOU-QEUMEHMPSA-N |
| XLogP | 4.19 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|