C24H22N6O4 — CID 5280161
1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 5280161) has the molecular formula C24H22N6O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5280161 |
| Molecular Formula | C24H22N6O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1H-pyrazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-c2ccn[nH]2)c2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C24H22N6O4/c1-34-18-14-26-20(17-7-8-27-28-17)21-19(18)16(13-25-21)22(31)24(33)30-11-9-29(10-12-30)23(32)15-5-3-2-4-6-15/h2-8,13-14,25H,9-12H2,1H3,(H,27,28) |
| InChIKey | ONTWBTUBVAJZCV-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|