C24H21N5O4S — CID 5280176
1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1,3-thiazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione (PubChem CID 5280176) has the molecular formula C24H21N5O4S and a molecular weight of 475.53 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1,3-thiazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1,3-thiazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5280176 |
| Molecular Formula | C24H21N5O4S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-[4-methoxy-7-(1,3-thiazol-5-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-c2cncs2)c2[nH]cc(C(=O)C(=O)N3CCN(C(=O)c4ccccc4)CC3)c12 |
| InChI | InChI=1S/C24H21N5O4S/c1-33-17-12-27-20(18-13-25-14-34-18)21-19(17)16(11-26-21)22(30)24(32)29-9-7-28(8-10-29)23(31)15-5-3-2-4-6-15/h2-6,11-14,26H,7-10H2,1H3 |
| InChIKey | GJOQAQJAQZQRGL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|