C25H23ClN6O3 — CID 5280231
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-chloro-7-(5-methyl-1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione (PubChem CID 5280231) has the molecular formula C25H23ClN6O3 and a molecular weight of 490.95 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-chloro-7-(5-methyl-1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-chloro-7-(5-methyl-1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 5280231 |
| Molecular Formula | C25H23ClN6O3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-[5-chloro-7-(5-methyl-1H-imidazol-2-yl)-1H-pyrrolo[3,2-b]pyridin-3-yl]ethane-1,2-dione |
| SMILES | Cc1cnc(-c2cc(Cl)nc3c(C(=O)C(=O)N4CCN(C(=O)c5ccccc5)C[C@H]4C)c[nH]c23)[nH]1 |
| InChI | InChI=1S/C25H23ClN6O3/c1-14-11-28-23(29-14)17-10-19(26)30-21-18(12-27-20(17)21)22(33)25(35)32-9-8-31(13-15(32)2)24(34)16-6-4-3-5-7-16/h3-7,10-12,15,27H,8-9,13H2,1-2H3,(H,28,29)/t15-/m1/s1 |
| InChIKey | WCSPTZRAFROBMI-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|