C25H22N6O3 — CID 5280235
1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-pyrimidin-5-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione (PubChem CID 5280235) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-pyrimidin-5-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione.
| Compound Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-pyrimidin-5-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 5280235 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 1-[(2R)-4-benzoyl-2-methylpiperazin-1-yl]-2-(7-pyrimidin-5-yl-1H-pyrrolo[3,2-b]pyridin-3-yl)ethane-1,2-dione |
| SMILES | C[C@@H]1CN(C(=O)c2ccccc2)CCN1C(=O)C(=O)c1c[nH]c2c(-c3cncnc3)ccnc12 |
| InChI | InChI=1S/C25H22N6O3/c1-16-14-30(24(33)17-5-3-2-4-6-17)9-10-31(16)25(34)23(32)20-13-29-21-19(7-8-28-22(20)21)18-11-26-15-27-12-18/h2-8,11-13,15-16,29H,9-10,14H2,1H3/t16-/m1/s1 |
| InChIKey | FVUIQVPDBGFGLM-MRXNPFEDSA-N |
| XLogP | 2.58 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|