C21H18N4O3 — CID 5280261
1-(4-benzoylpiperazin-1-yl)-2-(1,6-naphthyridin-2-yl)ethane-1,2-dione (PubChem CID 5280261) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(1,6-naphthyridin-2-yl)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(1,6-naphthyridin-2-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 5280261 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(1,6-naphthyridin-2-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2ccccc2)CC1)c1ccc2cnccc2n1 |
| InChI | InChI=1S/C21H18N4O3/c26-19(18-7-6-16-14-22-9-8-17(16)23-18)21(28)25-12-10-24(11-13-25)20(27)15-4-2-1-3-5-15/h1-9,14H,10-13H2 |
| InChIKey | LANSBYRLYZALMC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|