About (E)-4,6-dioxooct-2-enedioic acid
(E)-4,6-dioxooct-2-enedioic acid (PubChem CID 5280398) has the molecular formula C8H8O6
and a molecular weight of 200.15 g/mol. Its IUPAC name is (E)-4,6-dioxooct-2-enedioic acid.
Molecular Properties
| Compound Name | (E)-4,6-dioxooct-2-enedioic acid |
| PubChem CID | 5280398 |
| Molecular Formula | C8H8O6 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | (E)-4,6-dioxooct-2-enedioic acid |
| SMILES | O=C(O)/C=C/C(=O)CC(=O)CC(=O)O |
| InChI | InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1+ |
| InChIKey | GACSIVHAIFQKTC-OWOJBTEDSA-N |
| XLogP | -0.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-4,6-dioxooct-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4,6-dioxooct-2-enedioic acid?
The IUPAC name of (E)-4,6-dioxooct-2-enedioic acid (CID 5280398) is (E)-4,6-dioxooct-2-enedioic acid.
What is the SMILES notation for (E)-4,6-dioxooct-2-enedioic acid?
The canonical SMILES for (E)-4,6-dioxooct-2-enedioic acid is O=C(O)/C=C/C(=O)CC(=O)CC(=O)O.
What is the InChIKey of (E)-4,6-dioxooct-2-enedioic acid?
The InChIKey is GACSIVHAIFQKTC-OWOJBTEDSA-N. The full InChI is InChI=1S/C8H8O6/c9-5(1-2-7(11)12)3-6(10)4-8(13)14/h1-2H,3-4H2,(H,11,12)(H,13,14)/b2-1+.
What are the key properties of (E)-4,6-dioxooct-2-enedioic acid?
(E)-4,6-dioxooct-2-enedioic acid has a molecular weight of 200.15 g/mol, XLogP of -0.37, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4,6-dioxooct-2-enedioic acid is sourced from PubChem (CID 5280398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).