(2Z,4Z)-hexa-2,4-dienedioic acid

C6H6O4 — CID 5280518

IUPAC(2Z,4Z)-hexa-2,4-dienedioic acid
SMILESO=C(O)/C=C\C=C/C(=O)O
InChIInChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2-
InChIKeyTXXHDPDFNKHHGW-CCAGOZQPSA-N
MW142.11 g/mol
LogP0.27
Rot. Bonds3

About (2Z,4Z)-hexa-2,4-dienedioic acid

(2Z,4Z)-hexa-2,4-dienedioic acid (PubChem CID 5280518) has the molecular formula C6H6O4 and a molecular weight of 142.11 g/mol. Its IUPAC name is (2Z,4Z)-hexa-2,4-dienedioic acid.

Molecular Properties

Compound Name(2Z,4Z)-hexa-2,4-dienedioic acid
PubChem CID5280518
Molecular FormulaC6H6O4
Molecular Weight142.11 g/mol
Exact Mass142.03
IUPAC Name(2Z,4Z)-hexa-2,4-dienedioic acid
SMILESO=C(O)/C=C\C=C/C(=O)O
InChIInChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2-
InChIKeyTXXHDPDFNKHHGW-CCAGOZQPSA-N
XLogP0.27
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500142.11
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2Z,4Z)-hexa-2,4-dienedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2Z,4Z)-hexa-2,4-dienedioic acid?
The IUPAC name of (2Z,4Z)-hexa-2,4-dienedioic acid (CID 5280518) is (2Z,4Z)-hexa-2,4-dienedioic acid.
What is the SMILES notation for (2Z,4Z)-hexa-2,4-dienedioic acid?
The canonical SMILES for (2Z,4Z)-hexa-2,4-dienedioic acid is O=C(O)/C=C\C=C/C(=O)O.
What is the InChIKey of (2Z,4Z)-hexa-2,4-dienedioic acid?
The InChIKey is TXXHDPDFNKHHGW-CCAGOZQPSA-N. The full InChI is InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2-.
What are the key properties of (2Z,4Z)-hexa-2,4-dienedioic acid?
(2Z,4Z)-hexa-2,4-dienedioic acid has a molecular weight of 142.11 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-hexa-2,4-dienedioic acid is sourced from PubChem (CID 5280518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).