About (2Z,4Z)-hexa-2,4-dienedioic acid
(2Z,4Z)-hexa-2,4-dienedioic acid (PubChem CID 5280518) has the molecular formula C6H6O4
and a molecular weight of 142.11 g/mol. Its IUPAC name is (2Z,4Z)-hexa-2,4-dienedioic acid.
Molecular Properties
| Compound Name | (2Z,4Z)-hexa-2,4-dienedioic acid |
| PubChem CID | 5280518 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | (2Z,4Z)-hexa-2,4-dienedioic acid |
| SMILES | O=C(O)/C=C\C=C/C(=O)O |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2- |
| InChIKey | TXXHDPDFNKHHGW-CCAGOZQPSA-N |
| XLogP | 0.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4Z)-hexa-2,4-dienedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4Z)-hexa-2,4-dienedioic acid?
The IUPAC name of (2Z,4Z)-hexa-2,4-dienedioic acid (CID 5280518) is (2Z,4Z)-hexa-2,4-dienedioic acid.
What is the SMILES notation for (2Z,4Z)-hexa-2,4-dienedioic acid?
The canonical SMILES for (2Z,4Z)-hexa-2,4-dienedioic acid is O=C(O)/C=C\C=C/C(=O)O.
What is the InChIKey of (2Z,4Z)-hexa-2,4-dienedioic acid?
The InChIKey is TXXHDPDFNKHHGW-CCAGOZQPSA-N. The full InChI is InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2-.
What are the key properties of (2Z,4Z)-hexa-2,4-dienedioic acid?
(2Z,4Z)-hexa-2,4-dienedioic acid has a molecular weight of 142.11 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4Z)-hexa-2,4-dienedioic acid is sourced from PubChem (CID 5280518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).