About 2-phenylsulfanylpyrazine
2-phenylsulfanylpyrazine (PubChem CID 528052) has the molecular formula C10H8N2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-phenylsulfanylpyrazine.
Molecular Properties
| Compound Name | 2-phenylsulfanylpyrazine |
| PubChem CID | 528052 |
| Molecular Formula | C10H8N2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 2-phenylsulfanylpyrazine |
| SMILES | c1ccc(Sc2cnccn2)cc1 |
| InChI | InChI=1S/C10H8N2S/c1-2-4-9(5-3-1)13-10-8-11-6-7-12-10/h1-8H |
| InChIKey | VAUCOCSGTRUZBW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylsulfanylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylsulfanylpyrazine?
The IUPAC name of 2-phenylsulfanylpyrazine (CID 528052) is 2-phenylsulfanylpyrazine.
What is the SMILES notation for 2-phenylsulfanylpyrazine?
The canonical SMILES for 2-phenylsulfanylpyrazine is c1ccc(Sc2cnccn2)cc1.
What is the InChIKey of 2-phenylsulfanylpyrazine?
The InChIKey is VAUCOCSGTRUZBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S/c1-2-4-9(5-3-1)13-10-8-11-6-7-12-10/h1-8H.
What are the key properties of 2-phenylsulfanylpyrazine?
2-phenylsulfanylpyrazine has a molecular weight of 188.25 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylsulfanylpyrazine is sourced from PubChem (CID 528052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).