C17H18FN3O3 — CID 52807858
N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-methoxypyridine-3-carboxamide (PubChem CID 52807858) has the molecular formula C17H18FN3O3 and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 52807858 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-[2-[[2-(4-fluorophenyl)acetyl]amino]ethyl]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)NCCNC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FN3O3/c1-24-17-14(3-2-8-21-17)16(23)20-10-9-19-15(22)11-12-4-6-13(18)7-5-12/h2-8H,9-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | GNRPPMOAMBRFRE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|