About butyl N-(2,4-dimethylphenyl)carbamate
butyl N-(2,4-dimethylphenyl)carbamate (PubChem CID 528083) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is butyl N-(2,4-dimethylphenyl)carbamate.
Molecular Properties
| Compound Name | butyl N-(2,4-dimethylphenyl)carbamate |
| PubChem CID | 528083 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | butyl N-(2,4-dimethylphenyl)carbamate |
| SMILES | CCCCOC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C13H19NO2/c1-4-5-8-16-13(15)14-12-7-6-10(2)9-11(12)3/h6-7,9H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | JRICEOSBCKGWME-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-(2,4-dimethylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-(2,4-dimethylphenyl)carbamate?
The IUPAC name of butyl N-(2,4-dimethylphenyl)carbamate (CID 528083) is butyl N-(2,4-dimethylphenyl)carbamate.
What is the SMILES notation for butyl N-(2,4-dimethylphenyl)carbamate?
The canonical SMILES for butyl N-(2,4-dimethylphenyl)carbamate is CCCCOC(=O)Nc1ccc(C)cc1C.
What is the InChIKey of butyl N-(2,4-dimethylphenyl)carbamate?
The InChIKey is JRICEOSBCKGWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-4-5-8-16-13(15)14-12-7-6-10(2)9-11(12)3/h6-7,9H,4-5,8H2,1-3H3,(H,14,15).
What are the key properties of butyl N-(2,4-dimethylphenyl)carbamate?
butyl N-(2,4-dimethylphenyl)carbamate has a molecular weight of 221.30 g/mol, XLogP of 3.65, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-(2,4-dimethylphenyl)carbamate is sourced from PubChem (CID 528083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).