(2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid

C9H12O4 — CID 5280967

IUPAC(2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid
SMILESCC(C)C(=O)/C=C\C=C(\O)C(=O)O
InChIInChI=1S/C9H12O4/c1-6(2)7(10)4-3-5-8(11)9(12)13/h3-6,11H,1-2H3,(H,12,13)/b4-3-,8-5+
InChIKeyOEUMAONYVQQDBW-HMRFFJRGSA-N
MW184.19 g/mol
LogP1.29
Rot. Bonds4

About (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid

(2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid (PubChem CID 5280967) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid
PubChem CID5280967
Molecular FormulaC9H12O4
Molecular Weight184.19 g/mol
Exact Mass184.07
IUPAC Name(2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid
SMILESCC(C)C(=O)/C=C\C=C(\O)C(=O)O
InChIInChI=1S/C9H12O4/c1-6(2)7(10)4-3-5-8(11)9(12)13/h3-6,11H,1-2H3,(H,12,13)/b4-3-,8-5+
InChIKeyOEUMAONYVQQDBW-HMRFFJRGSA-N
XLogP1.29
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.19
LogP ≤ 51.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid?
The IUPAC name of (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid (CID 5280967) is (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid.
What is the SMILES notation for (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid?
The canonical SMILES for (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid is CC(C)C(=O)/C=C\C=C(\O)C(=O)O.
What is the InChIKey of (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid?
The InChIKey is OEUMAONYVQQDBW-HMRFFJRGSA-N. The full InChI is InChI=1S/C9H12O4/c1-6(2)7(10)4-3-5-8(11)9(12)13/h3-6,11H,1-2H3,(H,12,13)/b4-3-,8-5+.
What are the key properties of (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid?
(2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid has a molecular weight of 184.19 g/mol, XLogP of 1.29, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-2-hydroxy-7-methyl-6-oxoocta-2,4-dienoic acid is sourced from PubChem (CID 5280967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).