C16H20N2O4S — CID 52810332
N-ethyl-N-(2-methylprop-2-enyl)-2-(2,2,4-trioxo-1H-2λ6,3-benzothiazin-3-yl)acetamide (PubChem CID 52810332) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is N-ethyl-N-(2-methylprop-2-enyl)-2-(2,2,4-trioxo-1H-2λ6,3-benzothiazin-3-yl)acetamide.
| Compound Name | N-ethyl-N-(2-methylprop-2-enyl)-2-(2,2,4-trioxo-1H-2λ6,3-benzothiazin-3-yl)acetamide |
|---|---|
| PubChem CID | 52810332 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-ethyl-N-(2-methylprop-2-enyl)-2-(2,2,4-trioxo-1H-2λ6,3-benzothiazin-3-yl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)CN1C(=O)c2ccccc2CS1(=O)=O |
| InChI | InChI=1S/C16H20N2O4S/c1-4-17(9-12(2)3)15(19)10-18-16(20)14-8-6-5-7-13(14)11-23(18,21)22/h5-8H,2,4,9-11H2,1,3H3 |
| InChIKey | YVNOTAWNLLDYOP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|