About methyl (E)-dec-2-en-4,6,8-triynoate
methyl (E)-dec-2-en-4,6,8-triynoate (PubChem CID 5281146) has the molecular formula C11H8O2
and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl (E)-dec-2-en-4,6,8-triynoate.
Molecular Properties
| Compound Name | methyl (E)-dec-2-en-4,6,8-triynoate |
| PubChem CID | 5281146 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | methyl (E)-dec-2-en-4,6,8-triynoate |
| SMILES | CC#CC#CC#C/C=C/C(=O)OC |
| InChI | InChI=1S/C11H8O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h9-10H,1-2H3/b10-9+ |
| InChIKey | LBAVIXQTLKRIGP-MDZDMXLPSA-N |
| XLogP | 0.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-dec-2-en-4,6,8-triynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-dec-2-en-4,6,8-triynoate?
The IUPAC name of methyl (E)-dec-2-en-4,6,8-triynoate (CID 5281146) is methyl (E)-dec-2-en-4,6,8-triynoate.
What is the SMILES notation for methyl (E)-dec-2-en-4,6,8-triynoate?
The canonical SMILES for methyl (E)-dec-2-en-4,6,8-triynoate is CC#CC#CC#C/C=C/C(=O)OC.
What is the InChIKey of methyl (E)-dec-2-en-4,6,8-triynoate?
The InChIKey is LBAVIXQTLKRIGP-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H8O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h9-10H,1-2H3/b10-9+.
What are the key properties of methyl (E)-dec-2-en-4,6,8-triynoate?
methyl (E)-dec-2-en-4,6,8-triynoate has a molecular weight of 172.18 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-dec-2-en-4,6,8-triynoate is sourced from PubChem (CID 5281146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).