C13H10O2 — CID 5281147
(E,2R)-tridec-11-en-3,5,7,9-tetrayne-1,2-diol (PubChem CID 5281147) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is (E,2R)-tridec-11-en-3,5,7,9-tetrayne-1,2-diol.
| Compound Name | (E,2R)-tridec-11-en-3,5,7,9-tetrayne-1,2-diol |
|---|---|
| PubChem CID | 5281147 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (E,2R)-tridec-11-en-3,5,7,9-tetrayne-1,2-diol |
| SMILES | C/C=C/C#CC#CC#CC#C[C@@H](O)CO |
| InChI | InChI=1S/C13H10O2/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h2-3,13-15H,12H2,1H3/b3-2+/t13-/m1/s1 |
| InChIKey | CZFQZIRMRQWYEB-YWVDXFKGSA-N |
| XLogP | -0.07 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|