About (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol
(2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol (PubChem CID 5281151) has the molecular formula C12H14O2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol.
Molecular Properties
| Compound Name | (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol |
| PubChem CID | 5281151 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol |
| SMILES | CC#CC#C/C=C/[C@@H]1OCCC[C@H]1O |
| InChI | InChI=1S/C12H14O2/c1-2-3-4-5-6-9-12-11(13)8-7-10-14-12/h6,9,11-13H,7-8,10H2,1H3/b9-6+/t11-,12+/m1/s1 |
| InChIKey | DTZGSVQZSHOFEV-FIRGKKCLSA-N |
| XLogP | 1.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol?
The IUPAC name of (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol (CID 5281151) is (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol.
What is the SMILES notation for (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol?
The canonical SMILES for (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol is CC#CC#C/C=C/[C@@H]1OCCC[C@H]1O.
What is the InChIKey of (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol?
The InChIKey is DTZGSVQZSHOFEV-FIRGKKCLSA-N. The full InChI is InChI=1S/C12H14O2/c1-2-3-4-5-6-9-12-11(13)8-7-10-14-12/h6,9,11-13H,7-8,10H2,1H3/b9-6+/t11-,12+/m1/s1.
What are the key properties of (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol?
(2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol has a molecular weight of 190.24 g/mol, XLogP of 1.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3R)-2-[(E)-hept-1-en-3,5-diynyl]oxan-3-ol is sourced from PubChem (CID 5281151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).