C15H22O — CID 5281535
(2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal (PubChem CID 5281535) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal.
| Compound Name | (2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal |
|---|---|
| PubChem CID | 5281535 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (2E,6E)-2,6-dimethyl-10-methylidenedodeca-2,6,11-trienal |
| SMILES | C=CC(=C)CC/C=C(\C)CC/C=C(\C)C=O |
| InChI | InChI=1S/C15H22O/c1-5-13(2)8-6-9-14(3)10-7-11-15(4)12-16/h5,9,11-12H,1-2,6-8,10H2,3-4H3/b14-9+,15-11+ |
| InChIKey | NOPLRNXKHZRXHT-YFVJMOTDSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|