C11H8O5 — CID 5281571
2,3,4,5-tetrahydroxybenzo[7]annulen-6-one (PubChem CID 5281571) has the molecular formula C11H8O5 and a molecular weight of 220.18 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxybenzo[7]annulen-6-one.
| Compound Name | 2,3,4,5-tetrahydroxybenzo[7]annulen-6-one |
|---|---|
| PubChem CID | 5281571 |
| Molecular Formula | C11H8O5 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 2,3,4,5-tetrahydroxybenzo[7]annulen-6-one |
| SMILES | O=c1cccc2cc(O)c(O)c(O)c2c1O |
| InChI | InChI=1S/C11H8O5/c12-6-3-1-2-5-4-7(13)10(15)11(16)8(5)9(6)14/h1-4,13,15-16H,(H,12,14) |
| InChIKey | WDGFFVCWBZVLCE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|