About 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one
3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (PubChem CID 5281801) has the molecular formula C15H10O6
and a molecular weight of 286.24 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
Molecular Properties
| Compound Name | 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| PubChem CID | 5281801 |
| Molecular Formula | C15H10O6 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| SMILES | O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H |
| InChIKey | IOYHCQBYQJQBSK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one?
The IUPAC name of 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one (CID 5281801) is 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one.
What is the SMILES notation for 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one?
The canonical SMILES for 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one is O=c1c(-c2ccc(O)c(O)c2)coc2cc(O)cc(O)c12.
What is the InChIKey of 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one?
The InChIKey is IOYHCQBYQJQBSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10O6/c16-8-4-12(19)14-13(5-8)21-6-9(15(14)20)7-1-2-10(17)11(18)3-7/h1-6,16-19H.
What are the key properties of 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one?
3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one has a molecular weight of 286.24 g/mol, XLogP of 2.28, 1 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one is sourced from PubChem (CID 5281801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).