About 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one
1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one (PubChem CID 5281832) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one.
Molecular Properties
| Compound Name | 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one |
| PubChem CID | 5281832 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one |
| SMILES | COc1cc2c(c(O)c1OC)c(=O)c1ccccc1n2C |
| InChI | InChI=1S/C16H15NO4/c1-17-10-7-5-4-6-9(10)14(18)13-11(17)8-12(20-2)16(21-3)15(13)19/h4-8,19H,1-3H3 |
| InChIKey | ATBZZQPALSPNMF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one?
The IUPAC name of 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one (CID 5281832) is 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one.
What is the SMILES notation for 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one?
The canonical SMILES for 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one is COc1cc2c(c(O)c1OC)c(=O)c1ccccc1n2C.
What is the InChIKey of 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one?
The InChIKey is ATBZZQPALSPNMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-17-10-7-5-4-6-9(10)14(18)13-11(17)8-12(20-2)16(21-3)15(13)19/h4-8,19H,1-3H3.
What are the key properties of 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one?
1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one has a molecular weight of 285.30 g/mol, XLogP of 2.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,3-dimethoxy-10-methylacridin-9-one is sourced from PubChem (CID 5281832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).