C16H22O2 — CID 5281857
2-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol (PubChem CID 5281857) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 5281857 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]benzene-1,4-diol |
| SMILES | CC(C)=CCC/C(C)=C/Cc1cc(O)ccc1O |
| InChI | InChI=1S/C16H22O2/c1-12(2)5-4-6-13(3)7-8-14-11-15(17)9-10-16(14)18/h5,7,9-11,17-18H,4,6,8H2,1-3H3/b13-7+ |
| InChIKey | ZSCRTFONTNMQBL-NTUHNPAUSA-N |
| XLogP | 4.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|