(E)-2,6-dimethyl-5-methylidenehept-2-enoic acid

C10H16O2 — CID 5281995

IUPAC(E)-2,6-dimethyl-5-methylidenehept-2-enoic acid
SMILESC=C(C/C=C(\C)C(=O)O)C(C)C
InChIInChI=1S/C10H16O2/c1-7(2)8(3)5-6-9(4)10(11)12/h6-7H,3,5H2,1-2,4H3,(H,11,12)/b9-6+
InChIKeyHZNKOKJSWBRPRJ-RMKNXTFCSA-N
MW168.24 g/mol
LogP2.62
Rot. Bonds4

About (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid

(E)-2,6-dimethyl-5-methylidenehept-2-enoic acid (PubChem CID 5281995) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid.

Molecular Properties

Compound Name(E)-2,6-dimethyl-5-methylidenehept-2-enoic acid
PubChem CID5281995
Molecular FormulaC10H16O2
Molecular Weight168.24 g/mol
Exact Mass168.12
IUPAC Name(E)-2,6-dimethyl-5-methylidenehept-2-enoic acid
SMILESC=C(C/C=C(\C)C(=O)O)C(C)C
InChIInChI=1S/C10H16O2/c1-7(2)8(3)5-6-9(4)10(11)12/h6-7H,3,5H2,1-2,4H3,(H,11,12)/b9-6+
InChIKeyHZNKOKJSWBRPRJ-RMKNXTFCSA-N
XLogP2.62
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.24
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid?
The IUPAC name of (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid (CID 5281995) is (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid.
What is the SMILES notation for (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid?
The canonical SMILES for (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid is C=C(C/C=C(\C)C(=O)O)C(C)C.
What is the InChIKey of (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid?
The InChIKey is HZNKOKJSWBRPRJ-RMKNXTFCSA-N. The full InChI is InChI=1S/C10H16O2/c1-7(2)8(3)5-6-9(4)10(11)12/h6-7H,3,5H2,1-2,4H3,(H,11,12)/b9-6+.
What are the key properties of (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid?
(E)-2,6-dimethyl-5-methylidenehept-2-enoic acid has a molecular weight of 168.24 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,6-dimethyl-5-methylidenehept-2-enoic acid is sourced from PubChem (CID 5281995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).