About (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide
(Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide (PubChem CID 5282106) has the molecular formula C26H43NO3
and a molecular weight of 417.63 g/mol. Its IUPAC name is (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide.
Molecular Properties
| Compound Name | (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide |
| PubChem CID | 5282106 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C26H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(30)27-21-20-23-18-19-24(28)25(29)22-23/h9-10,18-19,22,28-29H,2-8,11-17,20-21H2,1H3,(H,27,30)/b10-9- |
| InChIKey | QQBPLXNESPTPNU-KTKRTIGZSA-N |
| XLogP | 6.79 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide?
The IUPAC name of (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide (CID 5282106) is (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide.
What is the SMILES notation for (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide?
The canonical SMILES for (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide is CCCCCCCC/C=C\CCCCCCCC(=O)NCCc1ccc(O)c(O)c1.
What is the InChIKey of (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide?
The InChIKey is QQBPLXNESPTPNU-KTKRTIGZSA-N. The full InChI is InChI=1S/C26H43NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-26(30)27-21-20-23-18-19-24(28)25(29)22-23/h9-10,18-19,22,28-29H,2-8,11-17,20-21H2,1H3,(H,27,30)/b10-9-.
What are the key properties of (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide?
(Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide has a molecular weight of 417.63 g/mol, XLogP of 6.79, 18 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-[2-(3,4-dihydroxyphenyl)ethyl]octadec-9-enamide is sourced from PubChem (CID 5282106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).