C20H41NO2 — CID 5282309
(E,2S,3R)-2-(dimethylamino)octadec-4-ene-1,3-diol (PubChem CID 5282309) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is (E,2S,3R)-2-(dimethylamino)octadec-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-(dimethylamino)octadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 5282309 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | (E,2S,3R)-2-(dimethylamino)octadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCCC/C=C/[C@@H](O)[C@H](CO)N(C)C |
| InChI | InChI=1S/C20H41NO2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)19(18-22)21(2)3/h16-17,19-20,22-23H,4-15,18H2,1-3H3/b17-16+/t19-,20+/m0/s1 |
| InChIKey | YRXOQXUDKDCXME-YIVRLKKSSA-N |
| XLogP | 4.53 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|