About 5-butyl-2,3-dimethylthiophene
5-butyl-2,3-dimethylthiophene (PubChem CID 528235) has the molecular formula C10H16S
and a molecular weight of 168.30 g/mol. Its IUPAC name is 5-butyl-2,3-dimethylthiophene.
Molecular Properties
| Compound Name | 5-butyl-2,3-dimethylthiophene |
| PubChem CID | 528235 |
| Molecular Formula | C10H16S |
| Molecular Weight | 168.30 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 5-butyl-2,3-dimethylthiophene |
| SMILES | CCCCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C10H16S/c1-4-5-6-10-7-8(2)9(3)11-10/h7H,4-6H2,1-3H3 |
| InChIKey | FBJKLGICJXNWFB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-butyl-2,3-dimethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2,3-dimethylthiophene?
The IUPAC name of 5-butyl-2,3-dimethylthiophene (CID 528235) is 5-butyl-2,3-dimethylthiophene.
What is the SMILES notation for 5-butyl-2,3-dimethylthiophene?
The canonical SMILES for 5-butyl-2,3-dimethylthiophene is CCCCc1cc(C)c(C)s1.
What is the InChIKey of 5-butyl-2,3-dimethylthiophene?
The InChIKey is FBJKLGICJXNWFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S/c1-4-5-6-10-7-8(2)9(3)11-10/h7H,4-6H2,1-3H3.
What are the key properties of 5-butyl-2,3-dimethylthiophene?
5-butyl-2,3-dimethylthiophene has a molecular weight of 168.30 g/mol, XLogP of 3.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2,3-dimethylthiophene is sourced from PubChem (CID 528235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).