About 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione
1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione (PubChem CID 5282554) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione |
| PubChem CID | 5282554 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione |
| SMILES | CC(O)Cn1c(=O)n(C)c(=O)c2cn(Cc3cccc4ccccc34)cc21 |
| InChI | InChI=1S/C21H21N3O3/c1-14(25)10-24-19-13-23(12-18(19)20(26)22(2)21(24)27)11-16-8-5-7-15-6-3-4-9-17(15)16/h3-9,12-14,25H,10-11H2,1-2H3 |
| InChIKey | KHMWDJWYHHFKPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione?
The IUPAC name of 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione (CID 5282554) is 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione.
What is the SMILES notation for 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione?
The canonical SMILES for 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione is CC(O)Cn1c(=O)n(C)c(=O)c2cn(Cc3cccc4ccccc34)cc21.
What is the InChIKey of 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione?
The InChIKey is KHMWDJWYHHFKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c1-14(25)10-24-19-13-23(12-18(19)20(26)22(2)21(24)27)11-16-8-5-7-15-6-3-4-9-17(15)16/h3-9,12-14,25H,10-11H2,1-2H3.
What are the key properties of 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione?
1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione has a molecular weight of 363.42 g/mol, XLogP of 2.08, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxypropyl)-3-methyl-6-(naphthalen-1-ylmethyl)pyrrolo[3,4-d]pyrimidine-2,4-dione is sourced from PubChem (CID 5282554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).