About (E)-dec-4-enoic acid
(E)-dec-4-enoic acid (PubChem CID 5282726) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (E)-dec-4-enoic acid.
Molecular Properties
| Compound Name | (E)-dec-4-enoic acid |
| PubChem CID | 5282726 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E)-dec-4-enoic acid |
| SMILES | CCCCC/C=C/CCC(=O)O |
| InChI | InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h6-7H,2-5,8-9H2,1H3,(H,11,12)/b7-6+ |
| InChIKey | XKZKQTCECFWKBN-VOTSOKGWSA-N |
| XLogP | 2.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-dec-4-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-dec-4-enoic acid?
The IUPAC name of (E)-dec-4-enoic acid (CID 5282726) is (E)-dec-4-enoic acid.
What is the SMILES notation for (E)-dec-4-enoic acid?
The canonical SMILES for (E)-dec-4-enoic acid is CCCCC/C=C/CCC(=O)O.
What is the InChIKey of (E)-dec-4-enoic acid?
The InChIKey is XKZKQTCECFWKBN-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H18O2/c1-2-3-4-5-6-7-8-9-10(11)12/h6-7H,2-5,8-9H2,1H3,(H,11,12)/b7-6+.
What are the key properties of (E)-dec-4-enoic acid?
(E)-dec-4-enoic acid has a molecular weight of 170.25 g/mol, XLogP of 2.99, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-dec-4-enoic acid is sourced from PubChem (CID 5282726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).