About (9E,11E)-octadeca-9,11-dienoic acid
(9E,11E)-octadeca-9,11-dienoic acid (PubChem CID 5282796) has the molecular formula C18H32O2
and a molecular weight of 280.45 g/mol. Its IUPAC name is (9E,11E)-octadeca-9,11-dienoic acid.
Molecular Properties
| Compound Name | (9E,11E)-octadeca-9,11-dienoic acid |
| PubChem CID | 5282796 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (9E,11E)-octadeca-9,11-dienoic acid |
| SMILES | CCCCCC/C=C/C=C/CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+ |
| InChIKey | JBYXPOFIGCOSSB-XBLVEGMJSA-N |
| XLogP | 5.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (9E,11E)-octadeca-9,11-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9E,11E)-octadeca-9,11-dienoic acid?
The IUPAC name of (9E,11E)-octadeca-9,11-dienoic acid (CID 5282796) is (9E,11E)-octadeca-9,11-dienoic acid.
What is the SMILES notation for (9E,11E)-octadeca-9,11-dienoic acid?
The canonical SMILES for (9E,11E)-octadeca-9,11-dienoic acid is CCCCCC/C=C/C=C/CCCCCCCC(=O)O.
What is the InChIKey of (9E,11E)-octadeca-9,11-dienoic acid?
The InChIKey is JBYXPOFIGCOSSB-XBLVEGMJSA-N. The full InChI is InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h7-10H,2-6,11-17H2,1H3,(H,19,20)/b8-7+,10-9+.
What are the key properties of (9E,11E)-octadeca-9,11-dienoic acid?
(9E,11E)-octadeca-9,11-dienoic acid has a molecular weight of 280.45 g/mol, XLogP of 5.88, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (9E,11E)-octadeca-9,11-dienoic acid is sourced from PubChem (CID 5282796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).