(10E,12Z)-octadeca-10,12-dienoic acid

C18H32O2 — CID 5282800

IUPAC(10E,12Z)-octadeca-10,12-dienoic acid
SMILESCCCCC/C=C\C=C\CCCCCCCCC(=O)O
InChIInChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-9H,2-5,10-17H2,1H3,(H,19,20)/b7-6-,9-8+
InChIKeyGKJZMAHZJGSBKD-NMMTYZSQSA-N
MW280.45 g/mol
LogP5.88
Rot. Bonds14

About (10E,12Z)-octadeca-10,12-dienoic acid

(10E,12Z)-octadeca-10,12-dienoic acid (PubChem CID 5282800) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (10E,12Z)-octadeca-10,12-dienoic acid.

Molecular Properties

Compound Name(10E,12Z)-octadeca-10,12-dienoic acid
PubChem CID5282800
Molecular FormulaC18H32O2
Molecular Weight280.45 g/mol
Exact Mass280.24
IUPAC Name(10E,12Z)-octadeca-10,12-dienoic acid
SMILESCCCCC/C=C\C=C\CCCCCCCCC(=O)O
InChIInChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-9H,2-5,10-17H2,1H3,(H,19,20)/b7-6-,9-8+
InChIKeyGKJZMAHZJGSBKD-NMMTYZSQSA-N
XLogP5.88
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds14
Heavy Atoms20
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500280.45
LogP ≤ 55.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (10E,12Z)-octadeca-10,12-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (10E,12Z)-octadeca-10,12-dienoic acid?
The IUPAC name of (10E,12Z)-octadeca-10,12-dienoic acid (CID 5282800) is (10E,12Z)-octadeca-10,12-dienoic acid.
What is the SMILES notation for (10E,12Z)-octadeca-10,12-dienoic acid?
The canonical SMILES for (10E,12Z)-octadeca-10,12-dienoic acid is CCCCC/C=C\C=C\CCCCCCCCC(=O)O.
What is the InChIKey of (10E,12Z)-octadeca-10,12-dienoic acid?
The InChIKey is GKJZMAHZJGSBKD-NMMTYZSQSA-N. The full InChI is InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-9H,2-5,10-17H2,1H3,(H,19,20)/b7-6-,9-8+.
What are the key properties of (10E,12Z)-octadeca-10,12-dienoic acid?
(10E,12Z)-octadeca-10,12-dienoic acid has a molecular weight of 280.45 g/mol, XLogP of 5.88, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (10E,12Z)-octadeca-10,12-dienoic acid is sourced from PubChem (CID 5282800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).