(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid

C20H30O2 — CID 5282847

IUPAC(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid
SMILESCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O
InChIInChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+,13-12+,16-15+
InChIKeyJAZBEHYOTPTENJ-RCHUDCCISA-N
MW302.46 g/mol
LogP5.99
Rot. Bonds13

About (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid

(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid (PubChem CID 5282847) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid.

Molecular Properties

Compound Name(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid
PubChem CID5282847
Molecular FormulaC20H30O2
Molecular Weight302.46 g/mol
Exact Mass302.22
IUPAC Name(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid
SMILESCC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O
InChIInChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+,13-12+,16-15+
InChIKeyJAZBEHYOTPTENJ-RCHUDCCISA-N
XLogP5.99
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms22
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500302.46
LogP ≤ 55.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid?
The IUPAC name of (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid (CID 5282847) is (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid.
What is the SMILES notation for (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid?
The canonical SMILES for (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid is CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)O.
What is the InChIKey of (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid?
The InChIKey is JAZBEHYOTPTENJ-RCHUDCCISA-N. The full InChI is InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,12-13,15-16H,2,5,8,11,14,17-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+,13-12+,16-15+.
What are the key properties of (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid?
(5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid has a molecular weight of 302.46 g/mol, XLogP of 5.99, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,8E,11E,14E,17E)-icosa-5,8,11,14,17-pentaenoic acid is sourced from PubChem (CID 5282847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).