C19H32O4 — CID 5282873
methyl (8E,12Z,15Z)-10-hydroperoxyoctadeca-8,12,15-trienoate (PubChem CID 5282873) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is methyl (8E,12Z,15Z)-10-hydroperoxyoctadeca-8,12,15-trienoate.
| Compound Name | methyl (8E,12Z,15Z)-10-hydroperoxyoctadeca-8,12,15-trienoate |
|---|---|
| PubChem CID | 5282873 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | methyl (8E,12Z,15Z)-10-hydroperoxyoctadeca-8,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\CC(/C=C/CCCCCCC(=O)OC)OO |
| InChI | InChI=1S/C19H32O4/c1-3-4-5-6-9-12-15-18(23-21)16-13-10-7-8-11-14-17-19(20)22-2/h4-5,9,12-13,16,18,21H,3,6-8,10-11,14-15,17H2,1-2H3/b5-4-,12-9-,16-13+ |
| InChIKey | JZABNNCYXIODDU-UNABKFHLSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|