C19H32O4 — CID 5282874
methyl (9Z,12Z,16E)-15-hydroperoxyoctadeca-9,12,16-trienoate (PubChem CID 5282874) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is methyl (9Z,12Z,16E)-15-hydroperoxyoctadeca-9,12,16-trienoate.
| Compound Name | methyl (9Z,12Z,16E)-15-hydroperoxyoctadeca-9,12,16-trienoate |
|---|---|
| PubChem CID | 5282874 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | methyl (9Z,12Z,16E)-15-hydroperoxyoctadeca-9,12,16-trienoate |
| SMILES | C/C=C/C(C/C=C\C/C=C\CCCCCCCC(=O)OC)OO |
| InChI | InChI=1S/C19H32O4/c1-3-15-18(23-21)16-13-11-9-7-5-4-6-8-10-12-14-17-19(20)22-2/h3,5,7,11,13,15,18,21H,4,6,8-10,12,14,16-17H2,1-2H3/b7-5-,13-11-,15-3+ |
| InChIKey | GSDDTQBCPWWRBN-GWENILSLSA-N |
| XLogP | 5.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|