About Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate
Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate (PubChem CID 5282890) has the molecular formula C19H32O6
and a molecular weight of 356.50 g/mol. Its IUPAC name is methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate.
Molecular Properties
| Compound Name | Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate |
| PubChem CID | 5282890 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate |
| SMILES | CC/C=C/CC1C=CC(OO1)C(CCCCCCCC(=O)OC)OO |
| InChI | InChI=1S/C19H32O6/c1-3-4-8-11-16-14-15-18(25-24-16)17(23-21)12-9-6-5-7-10-13-19(20)22-2/h4,8,14-18,21H,3,5-7,9-13H2,1-2H3/b8-4+ |
| InChIKey | QYIHGBRMANIEFK-XBXARRHUSA-N |
| XLogP | 4.10 |
| TPSA | 74.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | 407 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate?
The IUPAC name of Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate (CID 5282890) is methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate.
What is the SMILES notation for Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate?
The canonical SMILES for Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate is CC/C=C/CC1C=CC(OO1)C(CCCCCCCC(=O)OC)OO.
What is the InChIKey of Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate?
The InChIKey is QYIHGBRMANIEFK-XBXARRHUSA-N. The full InChI is InChI=1S/C19H32O6/c1-3-4-8-11-16-14-15-18(25-24-16)17(23-21)12-9-6-5-7-10-13-19(20)22-2/h4,8,14-18,21H,3,5-7,9-13H2,1-2H3/b8-4+.
What are the key properties of Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate?
Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate has a molecular weight of 356.50 g/mol, XLogP of 4.10, 14 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 9-hydroperoxy-10,13-epdioxy-11,15-octadecadienoate is sourced from PubChem (CID 5282890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).