C19H32O6 — CID 5282890
methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate (PubChem CID 5282890) has the molecular formula C19H32O6 and a molecular weight of 356.46 g/mol. Its IUPAC name is methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate.
| Compound Name | methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate |
|---|---|
| PubChem CID | 5282890 |
| Molecular Formula | C19H32O6 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | methyl 9-hydroperoxy-9-[6-[(E)-pent-2-enyl]-3,6-dihydro-1,2-dioxin-3-yl]nonanoate |
| SMILES | CC/C=C/CC1C=CC(C(CCCCCCCC(=O)OC)OO)OO1 |
| InChI | InChI=1S/C19H32O6/c1-3-4-8-11-16-14-15-18(25-24-16)17(23-21)12-9-6-5-7-10-13-19(20)22-2/h4,8,14-18,21H,3,5-7,9-13H2,1-2H3/b8-4+ |
| InChIKey | QYIHGBRMANIEFK-XBXARRHUSA-N |
| XLogP | 4.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|