About 3-hydroxyoctadecanoic acid
3-hydroxyoctadecanoic acid (PubChem CID 5282907) has the molecular formula C18H36O3
and a molecular weight of 300.48 g/mol. Its IUPAC name is 3-hydroxyoctadecanoic acid.
Molecular Properties
| Compound Name | 3-hydroxyoctadecanoic acid |
| PubChem CID | 5282907 |
| Molecular Formula | C18H36O3 |
| Molecular Weight | 300.48 g/mol |
| Exact Mass | 300.27 |
| IUPAC Name | 3-hydroxyoctadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21) |
| InChIKey | POMQYTSPMKEQNB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxyoctadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyoctadecanoic acid?
The IUPAC name of 3-hydroxyoctadecanoic acid (CID 5282907) is 3-hydroxyoctadecanoic acid.
What is the SMILES notation for 3-hydroxyoctadecanoic acid?
The canonical SMILES for 3-hydroxyoctadecanoic acid is CCCCCCCCCCCCCCCC(O)CC(=O)O.
What is the InChIKey of 3-hydroxyoctadecanoic acid?
The InChIKey is POMQYTSPMKEQNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21).
What are the key properties of 3-hydroxyoctadecanoic acid?
3-hydroxyoctadecanoic acid has a molecular weight of 300.48 g/mol, XLogP of 5.30, 16 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyoctadecanoic acid is sourced from PubChem (CID 5282907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).