About 3-hydroxydocosanoic acid
3-hydroxydocosanoic acid (PubChem CID 5282921) has the molecular formula C22H44O3
and a molecular weight of 356.59 g/mol. Its IUPAC name is 3-hydroxydocosanoic acid.
Molecular Properties
| Compound Name | 3-hydroxydocosanoic acid |
| PubChem CID | 5282921 |
| Molecular Formula | C22H44O3 |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.33 |
| IUPAC Name | 3-hydroxydocosanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCCCC(O)CC(=O)O |
| InChI | InChI=1S/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25/h21,23H,2-20H2,1H3,(H,24,25) |
| InChIKey | PNPWTPYWWUOMDS-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxydocosanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxydocosanoic acid?
The IUPAC name of 3-hydroxydocosanoic acid (CID 5282921) is 3-hydroxydocosanoic acid.
What is the SMILES notation for 3-hydroxydocosanoic acid?
The canonical SMILES for 3-hydroxydocosanoic acid is CCCCCCCCCCCCCCCCCCCC(O)CC(=O)O.
What is the InChIKey of 3-hydroxydocosanoic acid?
The InChIKey is PNPWTPYWWUOMDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(23)20-22(24)25/h21,23H,2-20H2,1H3,(H,24,25).
What are the key properties of 3-hydroxydocosanoic acid?
3-hydroxydocosanoic acid has a molecular weight of 356.59 g/mol, XLogP of 6.86, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxydocosanoic acid is sourced from PubChem (CID 5282921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).