About (E)-9,12,13-trihydroxyoctadec-10-enoic acid
(E)-9,12,13-trihydroxyoctadec-10-enoic acid (PubChem CID 5282966) has the molecular formula C18H34O5
and a molecular weight of 330.47 g/mol. Its IUPAC name is (E)-9,12,13-trihydroxyoctadec-10-enoic acid.
Molecular Properties
| Compound Name | (E)-9,12,13-trihydroxyoctadec-10-enoic acid |
| PubChem CID | 5282966 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (E)-9,12,13-trihydroxyoctadec-10-enoic acid |
| SMILES | CCCCCC(O)C(O)/C=C/C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+ |
| InChIKey | MDIUMSLCYIJBQC-BUHFOSPRSA-N |
| XLogP | 3.02 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-9,12,13-trihydroxyoctadec-10-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-9,12,13-trihydroxyoctadec-10-enoic acid?
The IUPAC name of (E)-9,12,13-trihydroxyoctadec-10-enoic acid (CID 5282966) is (E)-9,12,13-trihydroxyoctadec-10-enoic acid.
What is the SMILES notation for (E)-9,12,13-trihydroxyoctadec-10-enoic acid?
The canonical SMILES for (E)-9,12,13-trihydroxyoctadec-10-enoic acid is CCCCCC(O)C(O)/C=C/C(O)CCCCCCCC(=O)O.
What is the InChIKey of (E)-9,12,13-trihydroxyoctadec-10-enoic acid?
The InChIKey is MDIUMSLCYIJBQC-BUHFOSPRSA-N. The full InChI is InChI=1S/C18H34O5/c1-2-3-7-11-16(20)17(21)14-13-15(19)10-8-5-4-6-9-12-18(22)23/h13-17,19-21H,2-12H2,1H3,(H,22,23)/b14-13+.
What are the key properties of (E)-9,12,13-trihydroxyoctadec-10-enoic acid?
(E)-9,12,13-trihydroxyoctadec-10-enoic acid has a molecular weight of 330.47 g/mol, XLogP of 3.02, 15 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-9,12,13-trihydroxyoctadec-10-enoic acid is sourced from PubChem (CID 5282966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).