About 5-oxoheptanoic acid
5-oxoheptanoic acid (PubChem CID 5282979) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is 5-oxoheptanoic acid.
Molecular Properties
| Compound Name | 5-oxoheptanoic acid |
| PubChem CID | 5282979 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 5-oxoheptanoic acid |
| SMILES | CCC(=O)CCCC(=O)O |
| InChI | InChI=1S/C7H12O3/c1-2-6(8)4-3-5-7(9)10/h2-5H2,1H3,(H,9,10) |
| InChIKey | PHADZMIQVBXNAW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxoheptanoic acid?
The IUPAC name of 5-oxoheptanoic acid (CID 5282979) is 5-oxoheptanoic acid.
What is the SMILES notation for 5-oxoheptanoic acid?
The canonical SMILES for 5-oxoheptanoic acid is CCC(=O)CCCC(=O)O.
What is the InChIKey of 5-oxoheptanoic acid?
The InChIKey is PHADZMIQVBXNAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-6(8)4-3-5-7(9)10/h2-5H2,1H3,(H,9,10).
What are the key properties of 5-oxoheptanoic acid?
5-oxoheptanoic acid has a molecular weight of 144.17 g/mol, XLogP of 1.22, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxoheptanoic acid is sourced from PubChem (CID 5282979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).