About 5-oxononanoic acid
5-oxononanoic acid (PubChem CID 5282980) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 5-oxononanoic acid.
Molecular Properties
| Compound Name | 5-oxononanoic acid |
| PubChem CID | 5282980 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 5-oxononanoic acid |
| SMILES | CCCCC(=O)CCCC(=O)O |
| InChI | InChI=1S/C9H16O3/c1-2-3-5-8(10)6-4-7-9(11)12/h2-7H2,1H3,(H,11,12) |
| InChIKey | IOLZRTYKQAFXFB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-oxononanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxononanoic acid?
The IUPAC name of 5-oxononanoic acid (CID 5282980) is 5-oxononanoic acid.
What is the SMILES notation for 5-oxononanoic acid?
The canonical SMILES for 5-oxononanoic acid is CCCCC(=O)CCCC(=O)O.
What is the InChIKey of 5-oxononanoic acid?
The InChIKey is IOLZRTYKQAFXFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-2-3-5-8(10)6-4-7-9(11)12/h2-7H2,1H3,(H,11,12).
What are the key properties of 5-oxononanoic acid?
5-oxononanoic acid has a molecular weight of 172.22 g/mol, XLogP of 2.00, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxononanoic acid is sourced from PubChem (CID 5282980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).