About 2-decyl-3-ethoxypyrazine
2-decyl-3-ethoxypyrazine (PubChem CID 528299) has the molecular formula C16H28N2O
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-decyl-3-ethoxypyrazine.
Molecular Properties
| Compound Name | 2-decyl-3-ethoxypyrazine |
| PubChem CID | 528299 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 2-decyl-3-ethoxypyrazine |
| SMILES | CCCCCCCCCCc1nccnc1OCC |
| InChI | InChI=1S/C16H28N2O/c1-3-5-6-7-8-9-10-11-12-15-16(19-4-2)18-14-13-17-15/h13-14H,3-12H2,1-2H3 |
| InChIKey | NMEXWBIKLCVCPW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decyl-3-ethoxypyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decyl-3-ethoxypyrazine?
The IUPAC name of 2-decyl-3-ethoxypyrazine (CID 528299) is 2-decyl-3-ethoxypyrazine.
What is the SMILES notation for 2-decyl-3-ethoxypyrazine?
The canonical SMILES for 2-decyl-3-ethoxypyrazine is CCCCCCCCCCc1nccnc1OCC.
What is the InChIKey of 2-decyl-3-ethoxypyrazine?
The InChIKey is NMEXWBIKLCVCPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O/c1-3-5-6-7-8-9-10-11-12-15-16(19-4-2)18-14-13-17-15/h13-14H,3-12H2,1-2H3.
What are the key properties of 2-decyl-3-ethoxypyrazine?
2-decyl-3-ethoxypyrazine has a molecular weight of 264.41 g/mol, XLogP of 4.56, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decyl-3-ethoxypyrazine is sourced from PubChem (CID 528299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).