(10E,12E)-9-oxooctadeca-10,12-dienoic acid

C18H30O3 — CID 5283011

IUPAC(10E,12E)-9-oxooctadeca-10,12-dienoic acid
SMILESCCCCC/C=C/C=C/C(=O)CCCCCCCC(=O)O
InChIInChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6+,14-11+
InChIKeyLUZSWWYKKLTDHU-SIGMCMEVSA-N
MW294.43 g/mol
LogP5.06
Rot. Bonds14

About (10E,12E)-9-oxooctadeca-10,12-dienoic acid

(10E,12E)-9-oxooctadeca-10,12-dienoic acid (PubChem CID 5283011) has the molecular formula C18H30O3 and a molecular weight of 294.43 g/mol. Its IUPAC name is (10E,12E)-9-oxooctadeca-10,12-dienoic acid.

Molecular Properties

Compound Name(10E,12E)-9-oxooctadeca-10,12-dienoic acid
PubChem CID5283011
Molecular FormulaC18H30O3
Molecular Weight294.43 g/mol
Exact Mass294.22
IUPAC Name(10E,12E)-9-oxooctadeca-10,12-dienoic acid
SMILESCCCCC/C=C/C=C/C(=O)CCCCCCCC(=O)O
InChIInChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6+,14-11+
InChIKeyLUZSWWYKKLTDHU-SIGMCMEVSA-N
XLogP5.06
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds14
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500294.43
LogP ≤ 55.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (10E,12E)-9-oxooctadeca-10,12-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (10E,12E)-9-oxooctadeca-10,12-dienoic acid?
The IUPAC name of (10E,12E)-9-oxooctadeca-10,12-dienoic acid (CID 5283011) is (10E,12E)-9-oxooctadeca-10,12-dienoic acid.
What is the SMILES notation for (10E,12E)-9-oxooctadeca-10,12-dienoic acid?
The canonical SMILES for (10E,12E)-9-oxooctadeca-10,12-dienoic acid is CCCCC/C=C/C=C/C(=O)CCCCCCCC(=O)O.
What is the InChIKey of (10E,12E)-9-oxooctadeca-10,12-dienoic acid?
The InChIKey is LUZSWWYKKLTDHU-SIGMCMEVSA-N. The full InChI is InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8,11,14H,2-5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b8-6+,14-11+.
What are the key properties of (10E,12E)-9-oxooctadeca-10,12-dienoic acid?
(10E,12E)-9-oxooctadeca-10,12-dienoic acid has a molecular weight of 294.43 g/mol, XLogP of 5.06, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (10E,12E)-9-oxooctadeca-10,12-dienoic acid is sourced from PubChem (CID 5283011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).