(E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid

C20H38O5 — CID 5283023

IUPAC(E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid
SMILESCCCCCC(OC)C(O)C(/C=C/CCCCCCCC(=O)O)OC
InChIInChI=1S/C20H38O5/c1-4-5-11-14-17(24-2)20(23)18(25-3)15-12-9-7-6-8-10-13-16-19(21)22/h12,15,17-18,20,23H,4-11,13-14,16H2,1-3H3,(H,21,22)/b15-12+
InChIKeyMQWZCHDMBWJFTK-NTCAYCPXSA-N
MW358.52 g/mol
LogP4.33
Rot. Bonds17

About (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid

(E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid (PubChem CID 5283023) has the molecular formula C20H38O5 and a molecular weight of 358.52 g/mol. Its IUPAC name is (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid.

Molecular Properties

Compound Name(E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid
PubChem CID5283023
Molecular FormulaC20H38O5
Molecular Weight358.52 g/mol
Exact Mass358.27
IUPAC Name(E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid
SMILESCCCCCC(OC)C(O)C(/C=C/CCCCCCCC(=O)O)OC
InChIInChI=1S/C20H38O5/c1-4-5-11-14-17(24-2)20(23)18(25-3)15-12-9-7-6-8-10-13-16-19(21)22/h12,15,17-18,20,23H,4-11,13-14,16H2,1-3H3,(H,21,22)/b15-12+
InChIKeyMQWZCHDMBWJFTK-NTCAYCPXSA-N
XLogP4.33
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds17
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500358.52
LogP ≤ 54.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid?
The IUPAC name of (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid (CID 5283023) is (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid.
What is the SMILES notation for (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid?
The canonical SMILES for (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid is CCCCCC(OC)C(O)C(/C=C/CCCCCCCC(=O)O)OC.
What is the InChIKey of (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid?
The InChIKey is MQWZCHDMBWJFTK-NTCAYCPXSA-N. The full InChI is InChI=1S/C20H38O5/c1-4-5-11-14-17(24-2)20(23)18(25-3)15-12-9-7-6-8-10-13-16-19(21)22/h12,15,17-18,20,23H,4-11,13-14,16H2,1-3H3,(H,21,22)/b15-12+.
What are the key properties of (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid?
(E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid has a molecular weight of 358.52 g/mol, XLogP of 4.33, 17 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-12-hydroxy-11,13-dimethoxyoctadec-9-enoic acid is sourced from PubChem (CID 5283023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).