About 2-ethoxy-3-octylpyrazine
2-ethoxy-3-octylpyrazine (PubChem CID 528314) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-ethoxy-3-octylpyrazine.
Molecular Properties
| Compound Name | 2-ethoxy-3-octylpyrazine |
| PubChem CID | 528314 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 2-ethoxy-3-octylpyrazine |
| SMILES | CCCCCCCCc1nccnc1OCC |
| InChI | InChI=1S/C14H24N2O/c1-3-5-6-7-8-9-10-13-14(17-4-2)16-12-11-15-13/h11-12H,3-10H2,1-2H3 |
| InChIKey | XTUICNHKCKZJSI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-3-octylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-3-octylpyrazine?
The IUPAC name of 2-ethoxy-3-octylpyrazine (CID 528314) is 2-ethoxy-3-octylpyrazine.
What is the SMILES notation for 2-ethoxy-3-octylpyrazine?
The canonical SMILES for 2-ethoxy-3-octylpyrazine is CCCCCCCCc1nccnc1OCC.
What is the InChIKey of 2-ethoxy-3-octylpyrazine?
The InChIKey is XTUICNHKCKZJSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-3-5-6-7-8-9-10-13-14(17-4-2)16-12-11-15-13/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-ethoxy-3-octylpyrazine?
2-ethoxy-3-octylpyrazine has a molecular weight of 236.36 g/mol, XLogP of 3.78, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-3-octylpyrazine is sourced from PubChem (CID 528314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).